C23H26N4O5 — CID 171976349
N-[(E)-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 171976349) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[(E)-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 171976349 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[(E)-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N4O5/c1-17(2)5-4-6-18(3)13-14-32-21-10-7-19(8-11-21)16-24-25-22-12-9-20(26(28)29)15-23(22)27(30)31/h5,7-13,15-16,25H,4,6,14H2,1-3H3/b18-13+,24-16+ |
| InChIKey | IUXPTUXUVKLJNP-JCFMHDEVSA-N |
| XLogP | 6.02 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|