C20H14N4O6 — CID 6241136
[4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 6241136) has the molecular formula C20H14N4O6 and a molecular weight of 406.35 g/mol. Its IUPAC name is [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 6241136 |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [4-[(Z)-(phenylhydrazinylidene)methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\Nc2ccccc2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14N4O6/c25-20(15-10-17(23(26)27)12-18(11-15)24(28)29)30-19-8-6-14(7-9-19)13-21-22-16-4-2-1-3-5-16/h1-13,22H/b21-13- |
| InChIKey | XAJREJNDJQJEPO-BKUYFWCQSA-N |
| XLogP | 4.17 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|