C35H28N8O13 — CID 11193558
[4-[(E)-[[7-[(2E)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-7-oxohept-1-en-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 11193558) has the molecular formula C35H28N8O13 and a molecular weight of 768.65 g/mol. Its IUPAC name is [4-[(E)-[[7-[(2E)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-7-oxohept-1-en-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [4-[(E)-[[7-[(2E)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-7-oxohept-1-en-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 11193558 |
| Molecular Formula | C35H28N8O13 |
| Molecular Weight | 768.65 g/mol |
| Exact Mass | 768.18 |
| IUPAC Name | [4-[(E)-[[7-[(2E)-2-[[4-(3,5-dinitrobenzoyl)oxyphenyl]methylidene]hydrazinyl]-7-oxohept-1-en-2-yl]hydrazinylidene]methyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | C=C(CCCCC(=O)N/N=C/c1ccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1)N/N=C/c1ccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C35H28N8O13/c1-22(38-36-20-23-6-10-31(11-7-23)55-34(45)25-14-27(40(47)48)18-28(15-25)41(49)50)4-2-3-5-33(44)39-37-21-24-8-12-32(13-9-24)56-35(46)26-16-29(42(51)52)19-30(17-26)43(53)54/h6-21,38H,1-5H2,(H,39,44)/b36-20+,37-21+ |
| InChIKey | ICPXVSYYBAXFRR-UHQZYLKYSA-N |
| XLogP | 5.91 |
| TPSA | 291.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|