C25H21BrN4O6 — CID 6127919
[4-[(Z)-[4-[(2-bromobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 6127919) has the molecular formula C25H21BrN4O6 and a molecular weight of 553.37 g/mol. Its IUPAC name is [4-[(Z)-[4-[(2-bromobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-[4-[(2-bromobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6127919 |
| Molecular Formula | C25H21BrN4O6 |
| Molecular Weight | 553.37 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | [4-[(Z)-[4-[(2-bromobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(CCCNC(=O)c1ccccc1Br)N/N=C\c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H21BrN4O6/c26-22-5-2-1-4-21(22)24(32)27-15-3-6-23(31)29-28-16-17-7-13-20(14-8-17)36-25(33)18-9-11-19(12-10-18)30(34)35/h1-2,4-5,7-14,16H,3,6,15H2,(H,27,32)(H,29,31)/b28-16- |
| InChIKey | WJDAWQQSZWSSJQ-NTFVMDSBSA-N |
| XLogP | 4.24 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|