C20H21BrN4O6 — CID 135605802
N-[4-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]-4-nitrobenzamide (PubChem CID 135605802) has the molecular formula C20H21BrN4O6 and a molecular weight of 493.31 g/mol. Its IUPAC name is N-[4-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]-4-nitrobenzamide.
| Compound Name | N-[4-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 135605802 |
| Molecular Formula | C20H21BrN4O6 |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | N-[4-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-4-oxobutyl]-4-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CCCNC(=O)c2ccc([N+](=O)[O-])cc2)cc(Br)c1O |
| InChI | InChI=1S/C20H21BrN4O6/c1-2-31-17-11-13(10-16(21)19(17)27)12-23-24-18(26)4-3-9-22-20(28)14-5-7-15(8-6-14)25(29)30/h5-8,10-12,27H,2-4,9H2,1H3,(H,22,28)(H,24,26)/b23-12+ |
| InChIKey | VHIUMOQEGKSLBR-FSJBWODESA-N |
| XLogP | 3.12 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|