C28H28N4O9 — CID 6130386
[4-[(E)-[4-[(4-nitrobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 6130386) has the molecular formula C28H28N4O9 and a molecular weight of 564.55 g/mol. Its IUPAC name is [4-[(E)-[4-[(4-nitrobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(E)-[4-[(4-nitrobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 6130386 |
| Molecular Formula | C28H28N4O9 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | [4-[(E)-[4-[(4-nitrobenzoyl)amino]butanoylhydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(/C=N/NC(=O)CCCNC(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H28N4O9/c1-38-23-15-20(16-24(39-2)26(23)40-3)28(35)41-22-12-6-18(7-13-22)17-30-31-25(33)5-4-14-29-27(34)19-8-10-21(11-9-19)32(36)37/h6-13,15-17H,4-5,14H2,1-3H3,(H,29,34)(H,31,33)/b30-17+ |
| InChIKey | AGJIOWFQEUSMAG-OCSSWDANSA-N |
| XLogP | 3.50 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|