C22H26BrN3O5 — CID 5000295
N-[3-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide (PubChem CID 5000295) has the molecular formula C22H26BrN3O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[3-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide.
| Compound Name | N-[3-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 5000295 |
| Molecular Formula | C22H26BrN3O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[3-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccc(OC)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C22H26BrN3O5/c1-4-30-19-13-15(12-18(23)21(19)31-5-2)14-25-26-20(27)10-11-24-22(28)16-6-8-17(29-3)9-7-16/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | JFKYCDUCOAIXIM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|