C21H24IN3O5 — CID 4546110
N-[3-[2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide (PubChem CID 4546110) has the molecular formula C21H24IN3O5 and a molecular weight of 525.34 g/mol. Its IUPAC name is N-[3-[2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide.
| Compound Name | N-[3-[2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 4546110 |
| Molecular Formula | C21H24IN3O5 |
| Molecular Weight | 525.34 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-[3-[2-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]-4-methoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccc(OC)cc2)cc(I)c1OC |
| InChI | InChI=1S/C21H24IN3O5/c1-4-30-18-12-14(11-17(22)20(18)29-3)13-24-25-19(26)9-10-23-21(27)15-5-7-16(28-2)8-6-15/h5-8,11-13H,4,9-10H2,1-3H3,(H,23,27)(H,25,26) |
| InChIKey | WRRNXCUCWSVQKL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|