C23H28IN3O5 — CID 4555556
N-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide (PubChem CID 4555556) has the molecular formula C23H28IN3O5 and a molecular weight of 553.40 g/mol. Its IUPAC name is N-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide.
| Compound Name | N-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 4555556 |
| Molecular Formula | C23H28IN3O5 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | N-[(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
| SMILES | CCOc1cc(C=NNC(=O)C(C)NC(=O)Cc2ccc(OC)cc2)cc(I)c1OCC |
| InChI | InChI=1S/C23H28IN3O5/c1-5-31-20-12-17(11-19(24)22(20)32-6-2)14-25-27-23(29)15(3)26-21(28)13-16-7-9-18(30-4)10-8-16/h7-12,14-15H,5-6,13H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | QPGQKHDWICTPOK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|