C23H26IN3O5 — CID 4679761
N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide (PubChem CID 4679761) has the molecular formula C23H26IN3O5 and a molecular weight of 551.38 g/mol. Its IUPAC name is N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide.
| Compound Name | N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 4679761 |
| Molecular Formula | C23H26IN3O5 |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-[[2-(4-methoxyphenyl)acetyl]amino]propanamide |
| SMILES | C=CCOc1c(I)cc(C=NNC(=O)C(C)NC(=O)Cc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C23H26IN3O5/c1-5-10-32-22-19(24)11-17(12-20(22)31-4)14-25-27-23(29)15(2)26-21(28)13-16-6-8-18(30-3)9-7-16/h5-9,11-12,14-15H,1,10,13H2,2-4H3,(H,26,28)(H,27,29) |
| InChIKey | KIEKZLXPZVCEIU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|