C19H19FIN3O4 — CID 3512736
2-fluoro-N-[3-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 3512736) has the molecular formula C19H19FIN3O4 and a molecular weight of 499.28 g/mol. Its IUPAC name is 2-fluoro-N-[3-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 3512736 |
| Molecular Formula | C19H19FIN3O4 |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-fluoro-N-[3-[2-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | COc1cc(C=NNC(=O)CCNC(=O)c2ccccc2F)cc(I)c1OC |
| InChI | InChI=1S/C19H19FIN3O4/c1-27-16-10-12(9-15(21)18(16)28-2)11-23-24-17(25)7-8-22-19(26)13-5-3-4-6-14(13)20/h3-6,9-11H,7-8H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | LHHJDKWXLYBDQA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|