C22H25N3O7 — CID 3532553
methyl 2-[2-methoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3532553) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3532553 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl 2-[2-methoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=NNC(=O)CCNC(=O)c2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C22H25N3O7/c1-29-17-7-5-16(6-8-17)22(28)23-11-10-20(26)25-24-13-15-4-9-18(19(12-15)30-2)32-14-21(27)31-3/h4-9,12-13H,10-11,14H2,1-3H3,(H,23,28)(H,25,26) |
| InChIKey | MGSYEXJVUZXDNP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|