C26H27N3O5 — CID 5005619
4-methoxy-N-[3-[2-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 5005619) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 4-methoxy-N-[3-[2-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[2-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 5005619 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 4-methoxy-N-[3-[2-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | COc1ccc(COc2ccc(C=NNC(=O)CCNC(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-32-22-9-5-20(6-10-22)18-34-24-11-3-19(4-12-24)17-28-29-25(30)15-16-27-26(31)21-7-13-23(33-2)14-8-21/h3-14,17H,15-16,18H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | JARWAYAWALMGFI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|