C23H26BrN3O7 — CID 4536340
methyl 2-[2-bromo-6-ethoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4536340) has the molecular formula C23H26BrN3O7 and a molecular weight of 536.38 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4536340 |
| Molecular Formula | C23H26BrN3O7 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[[3-[(4-methoxybenzoyl)amino]propanoylhydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)CCNC(=O)c2ccc(OC)cc2)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C23H26BrN3O7/c1-4-33-19-12-15(11-18(24)22(19)34-14-21(29)32-3)13-26-27-20(28)9-10-25-23(30)16-5-7-17(31-2)8-6-16/h5-8,11-13H,4,9-10,14H2,1-3H3,(H,25,30)(H,27,28) |
| InChIKey | WQXBMHDKQJXNCN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|