C23H25Cl2N3O6 — CID 4285725
ethyl 2-[4-[[3-[(3,4-dichlorobenzoyl)amino]propanoylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 4285725) has the molecular formula C23H25Cl2N3O6 and a molecular weight of 510.37 g/mol. Its IUPAC name is ethyl 2-[4-[[3-[(3,4-dichlorobenzoyl)amino]propanoylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-[(3,4-dichlorobenzoyl)amino]propanoylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 4285725 |
| Molecular Formula | C23H25Cl2N3O6 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | ethyl 2-[4-[[3-[(3,4-dichlorobenzoyl)amino]propanoylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)CCNC(=O)c2ccc(Cl)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C23H25Cl2N3O6/c1-3-32-20-11-15(5-8-19(20)34-14-22(30)33-4-2)13-27-28-21(29)9-10-26-23(31)16-6-7-17(24)18(25)12-16/h5-8,11-13H,3-4,9-10,14H2,1-2H3,(H,26,31)(H,28,29) |
| InChIKey | TXJQMAHBJCWJDP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|