C23H27N3O7 — CID 4019862
methyl 2-[2-ethoxy-4-[[[4-(4-methoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4019862) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-4-[[[4-(4-methoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-4-[[[4-(4-methoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4019862 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | methyl 2-[2-ethoxy-4-[[[4-(4-methoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2ccc(OC)cc2)ccc1OCC(=O)OC |
| InChI | InChI=1S/C23H27N3O7/c1-4-32-20-13-16(5-10-19(20)33-15-23(29)31-3)14-24-26-22(28)12-11-21(27)25-17-6-8-18(30-2)9-7-17/h5-10,13-14H,4,11-12,15H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | FNPABHJAXDLIMK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|