C24H31N3O4 — CID 3961761
N'-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-N-(4-methylphenyl)butanediamide (PubChem CID 3961761) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N'-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-N-(4-methylphenyl)butanediamide.
| Compound Name | N'-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-N-(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 3961761 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N'-[(4-butoxy-3-ethoxyphenyl)methylideneamino]-N-(4-methylphenyl)butanediamide |
| SMILES | CCCCOc1ccc(C=NNC(=O)CCC(=O)Nc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C24H31N3O4/c1-4-6-15-31-21-12-9-19(16-22(21)30-5-2)17-25-27-24(29)14-13-23(28)26-20-10-7-18(3)8-11-20/h7-12,16-17H,4-6,13-15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | PZWZNPAMQBECCP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|