C25H17N3O6 — CID 3128054
[4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 3128054) has the molecular formula C25H17N3O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3128054 |
| Molecular Formula | C25H17N3O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [4-[[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)c2cc3ccccc3cc2O)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H17N3O6/c29-23-14-19-4-2-1-3-18(19)13-22(23)24(30)27-26-15-16-5-11-21(12-6-16)34-25(31)17-7-9-20(10-8-17)28(32)33/h1-15,29H,(H,27,30) |
| InChIKey | CTSUYTRUGGROAJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|