C21H24N2O3 — CID 3690699
[4-[(heptanoylhydrazinylidene)methyl]phenyl] benzoate (PubChem CID 3690699) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [4-[(heptanoylhydrazinylidene)methyl]phenyl] benzoate.
| Compound Name | [4-[(heptanoylhydrazinylidene)methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3690699 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [4-[(heptanoylhydrazinylidene)methyl]phenyl] benzoate |
| SMILES | CCCCCCC(=O)NN=Cc1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-3-4-8-11-20(24)23-22-16-17-12-14-19(15-13-17)26-21(25)18-9-6-5-7-10-18/h5-7,9-10,12-16H,2-4,8,11H2,1H3,(H,23,24) |
| InChIKey | ALDOBSHTAIPUHC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|