C24H29BrN2O3 — CID 6380374
[4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate (PubChem CID 6380374) has the molecular formula C24H29BrN2O3 and a molecular weight of 473.41 g/mol. Its IUPAC name is [4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6380374 |
| Molecular Formula | C24H29BrN2O3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [4-[(Z)-(decanoylhydrazinylidene)methyl]phenyl] 4-bromobenzoate |
| SMILES | CCCCCCCCCC(=O)N/N=C\c1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H29BrN2O3/c1-2-3-4-5-6-7-8-9-23(28)27-26-18-19-10-16-22(17-11-19)30-24(29)20-12-14-21(25)15-13-20/h10-18H,2-9H2,1H3,(H,27,28)/b26-18- |
| InChIKey | NNWHBGGNSDLQOG-ITYLOYPMSA-N |
| XLogP | 6.26 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|