C11H11N5O4S — CID 135752106
3-nitro-4-[(2E)-2-(1H-pyrrol-2-ylmethylidene)hydrazinyl]benzenesulfonamide (PubChem CID 135752106) has the molecular formula C11H11N5O4S and a molecular weight of 309.31 g/mol. Its IUPAC name is 3-nitro-4-[(2E)-2-(1H-pyrrol-2-ylmethylidene)hydrazinyl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[(2E)-2-(1H-pyrrol-2-ylmethylidene)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135752106 |
| Molecular Formula | C11H11N5O4S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-nitro-4-[(2E)-2-(1H-pyrrol-2-ylmethylidene)hydrazinyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N/N=C/c2ccc[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N5O4S/c12-21(19,20)9-3-4-10(11(6-9)16(17)18)15-14-7-8-2-1-5-13-8/h1-7,13,15H,(H2,12,19,20)/b14-7+ |
| InChIKey | GURLBPOZCBFOIA-VGOFMYFVSA-N |
| XLogP | 1.02 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|