C16H18N4O7S — CID 3424586
3-nitro-4-[2-[(2,4,6-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 3424586) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is 3-nitro-4-[2-[(2,4,6-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[2-[(2,4,6-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3424586 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-nitro-4-[2-[(2,4,6-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | COc1cc(OC)c(C=NNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C16H18N4O7S/c1-25-10-6-15(26-2)12(16(7-10)27-3)9-18-19-13-5-4-11(28(17,23)24)8-14(13)20(21)22/h4-9,19H,1-3H3,(H2,17,23,24) |
| InChIKey | GMZGCDRIELDKIN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|