C12H12N4O4S2 — CID 6043053
4-[(2Z)-2-[(3-methylthiophen-2-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 6043053) has the molecular formula C12H12N4O4S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-[(2Z)-2-[(3-methylthiophen-2-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[(3-methylthiophen-2-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6043053 |
| Molecular Formula | C12H12N4O4S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-[(2Z)-2-[(3-methylthiophen-2-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccsc1/C=N\Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O4S2/c1-8-4-5-21-12(8)7-14-15-10-3-2-9(22(13,19)20)6-11(10)16(17)18/h2-7,15H,1H3,(H2,13,19,20)/b14-7- |
| InChIKey | SCHNSCVFLLKIRG-AUWJEWJLSA-N |
| XLogP | 2.06 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_B(4)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|