C17H13ClN4O5S — CID 18280389
4-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 18280389) has the molecular formula C17H13ClN4O5S and a molecular weight of 420.83 g/mol. Its IUPAC name is 4-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18280389 |
| Molecular Formula | C17H13ClN4O5S |
| Molecular Weight | 420.83 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 4-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N/N=C/c2ccc(-c3ccc(Cl)cc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13ClN4O5S/c18-12-3-1-11(2-4-12)17-8-5-13(27-17)10-20-21-15-7-6-14(28(19,25)26)9-16(15)22(23)24/h1-10,21H,(H2,19,25,26)/b20-10+ |
| InChIKey | RXDOKQJMXQPGMH-KEBDBYFISA-N |
| XLogP | 3.60 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|