C17H16N4O5S2 — CID 50883679
4-[5-[[(4-sulfamoylphenyl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide (PubChem CID 50883679) has the molecular formula C17H16N4O5S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[5-[[(4-sulfamoylphenyl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[[(4-sulfamoylphenyl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 50883679 |
| Molecular Formula | C17H16N4O5S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-[5-[[(4-sulfamoylphenyl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NN=Cc2ccc(-c3ccc(S(N)(=O)=O)cc3)o2)cc1 |
| InChI | InChI=1S/C17H16N4O5S2/c18-27(22,23)15-6-1-12(2-7-15)17-10-5-14(26-17)11-20-21-13-3-8-16(9-4-13)28(19,24)25/h1-11,21H,(H2,18,22,23)(H2,19,24,25) |
| InChIKey | AXCPXLGUNARUCP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|