C19H17N5O3S2 — CID 6218436
4-[5-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide (PubChem CID 6218436) has the molecular formula C19H17N5O3S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[5-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 6218436 |
| Molecular Formula | C19H17N5O3S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-[5-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]furan-2-yl]benzenesulfonamide |
| SMILES | Cc1sc2ncnc(N/N=C\c3ccc(-c4ccc(S(N)(=O)=O)cc4)o3)c2c1C |
| InChI | InChI=1S/C19H17N5O3S2/c1-11-12(2)28-19-17(11)18(21-10-22-19)24-23-9-14-5-8-16(27-14)13-3-6-15(7-4-13)29(20,25)26/h3-10H,1-2H3,(H2,20,25,26)(H,21,22,24)/b23-9- |
| InChIKey | OHIMBHMHIBYWEK-AQHIEDMUSA-N |
| XLogP | 3.66 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_F(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|