C15H12N5O3S- — CID 7452229
4-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 7452229) has the molecular formula C15H12N5O3S- and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7452229 |
| Molecular Formula | C15H12N5O3S- |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | Cc1sc2ncnc(N/N=C\c3ccc([O-])c([N+](=O)[O-])c3)c2c1C |
| InChI | InChI=1S/C15H13N5O3S/c1-8-9(2)24-15-13(8)14(16-7-17-15)19-18-6-10-3-4-12(21)11(5-10)20(22)23/h3-7,21H,1-2H3,(H,16,17,19)/p-1/b18-6- |
| InChIKey | MPMQIBLIICOMBB-FXBPXSCXSA-M |
| XLogP | 2.74 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|