C25H16N6O4S2 — CID 6018816
N-[(Z)-(3-nitrophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 6018816) has the molecular formula C25H16N6O4S2 and a molecular weight of 528.58 g/mol. Its IUPAC name is N-[(Z)-(3-nitrophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 6018816 |
| Molecular Formula | C25H16N6O4S2 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(/C=N\Nc2ncnc3sc(Sc4ccccc4[N+](=O)[O-])c(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C25H16N6O4S2/c32-30(33)18-10-6-7-16(13-18)14-28-29-23-22-21(17-8-2-1-3-9-17)25(37-24(22)27-15-26-23)36-20-12-5-4-11-19(20)31(34)35/h1-15H,(H,26,27,29)/b28-14- |
| InChIKey | PRVZNEJFRXLIBB-MUXKCCDJSA-N |
| XLogP | 6.77 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|