C21H13N5O3 — CID 11646656
N-[(E)-(3-nitrophenyl)methylideneamino]-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine (PubChem CID 11646656) has the molecular formula C21H13N5O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[(E)-(3-nitrophenyl)methylideneamino]-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine.
| Compound Name | N-[(E)-(3-nitrophenyl)methylideneamino]-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
|---|---|
| PubChem CID | 11646656 |
| Molecular Formula | C21H13N5O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[(E)-(3-nitrophenyl)methylideneamino]-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2ncnc3c2oc2ccc4ccccc4c23)c1 |
| InChI | InChI=1S/C21H13N5O3/c27-26(28)15-6-3-4-13(10-15)11-24-25-21-20-19(22-12-23-21)18-16-7-2-1-5-14(16)8-9-17(18)29-20/h1-12H,(H,22,23,25)/b24-11+ |
| InChIKey | SLSBVGPTQNNHQB-BHGWPJFGSA-N |
| XLogP | 4.88 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|