C14H10N4O3 — CID 122707156
N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3-benzoxazol-2-amine (PubChem CID 122707156) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 122707156 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(/C=N\Nc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C14H10N4O3/c19-18(20)11-5-3-4-10(8-11)9-15-17-14-16-12-6-1-2-7-13(12)21-14/h1-9H,(H,16,17)/b15-9- |
| InChIKey | LCYSIDYYYXMXNT-DHDCSXOGSA-N |
| XLogP | 3.18 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|