C14H10BrN3O — CID 6243908
N-[(Z)-(4-bromophenyl)methylideneamino]-1,3-benzoxazol-2-amine (PubChem CID 6243908) has the molecular formula C14H10BrN3O and a molecular weight of 316.16 g/mol. Its IUPAC name is N-[(Z)-(4-bromophenyl)methylideneamino]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(Z)-(4-bromophenyl)methylideneamino]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 6243908 |
| Molecular Formula | C14H10BrN3O |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | N-[(Z)-(4-bromophenyl)methylideneamino]-1,3-benzoxazol-2-amine |
| SMILES | Brc1ccc(/C=N\Nc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C14H10BrN3O/c15-11-7-5-10(6-8-11)9-16-18-14-17-12-3-1-2-4-13(12)19-14/h1-9H,(H,17,18)/b16-9- |
| InChIKey | WDXXKZQGXPUKCW-SXGWCWSVSA-N |
| XLogP | 4.04 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|