C16H15N3O3 — CID 3111005
N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-benzoxazol-2-amine (PubChem CID 3111005) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 3111005 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methylideneamino]-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc(C=NNc2nc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C16H15N3O3/c1-20-14-8-7-11(9-15(14)21-2)10-17-19-16-18-12-5-3-4-6-13(12)22-16/h3-10H,1-2H3,(H,18,19) |
| InChIKey | YRONOUXWYIBQQO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|