C16H16N2O3 — CID 60715920
N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazol-2-amine (PubChem CID 60715920) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 60715920 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc(CNc2nc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C16H16N2O3/c1-19-14-8-7-11(9-15(14)20-2)10-17-16-18-12-5-3-4-6-13(12)21-16/h3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | PDEFZDRISIWKEV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |