C15H12N2O3 — CID 33286552
N-(1,3-benzodioxol-5-ylmethyl)-1,3-benzoxazol-2-amine (PubChem CID 33286552) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 33286552 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1,3-benzoxazol-2-amine |
| SMILES | c1ccc2oc(NCc3ccc4c(c3)OCO4)nc2c1 |
| InChI | InChI=1S/C15H12N2O3/c1-2-4-12-11(3-1)17-15(20-12)16-8-10-5-6-13-14(7-10)19-9-18-13/h1-7H,8-9H2,(H,16,17) |
| InChIKey | QUCXOCPHEQBPDY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |