C13H13N2O2+ — CID 4614540
N-(1,3-benzodioxol-5-ylmethyl)pyridin-1-ium-2-amine (PubChem CID 4614540) has the molecular formula C13H13N2O2+ and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)pyridin-1-ium-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 4614540 |
| Molecular Formula | C13H13N2O2+ |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)pyridin-1-ium-2-amine |
| SMILES | c1ccc(NCc2ccc3c(c2)OCO3)[nH+]c1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-6-14-13(3-1)15-8-10-4-5-11-12(7-10)17-9-16-11/h1-7H,8-9H2,(H,14,15)/p+1 |
| InChIKey | HBFBNKLYQHZPNA-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 44.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |