C13H12N3O4+ — CID 9196194
N-(1,3-benzodioxol-5-ylmethyl)-3-nitropyridin-1-ium-2-amine (PubChem CID 9196194) has the molecular formula C13H12N3O4+ and a molecular weight of 274.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9196194 |
| Molecular Formula | C13H12N3O4+ |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H11N3O4/c17-16(18)10-2-1-5-14-13(10)15-7-9-3-4-11-12(6-9)20-8-19-11/h1-6H,7-8H2,(H,14,15)/p+1 |
| InChIKey | DYIRNRYQIRXIEG-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|