C16H13N3O4 — CID 47044501
3-(1,3-benzodioxol-5-ylmethylamino)-4-methyl-5-nitrobenzonitrile (PubChem CID 47044501) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-4-methyl-5-nitrobenzonitrile.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-methyl-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 47044501 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-methyl-5-nitrobenzonitrile |
| SMILES | Cc1c(NCc2ccc3c(c2)OCO3)cc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O4/c1-10-13(4-12(7-17)5-14(10)19(20)21)18-8-11-2-3-15-16(6-11)23-9-22-15/h2-6,18H,8-9H2,1H3 |
| InChIKey | FXKZFOYXQVEJCU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|