C15H16N3O4+ — CID 9113187
N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9113187) has the molecular formula C15H16N3O4+ and a molecular weight of 302.31 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9113187 |
| Molecular Formula | C15H16N3O4+ |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H15N3O4/c19-18(20)12-2-1-6-16-15(12)17-7-5-11-3-4-13-14(10-11)22-9-8-21-13/h1-4,6,10H,5,7-9H2,(H,16,17)/p+1 |
| InChIKey | LHVZYROHPPKNPE-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|