C14H13N3O4 — CID 16564066
N-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitropyridin-2-amine (PubChem CID 16564066) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 16564066 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C14H13N3O4/c18-17(19)11-2-4-14(16-8-11)15-6-5-10-1-3-12-13(7-10)21-9-20-12/h1-4,7-8H,5-6,9H2,(H,15,16) |
| InChIKey | XJIUTLULSXVELB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|