C21H20N6O6 — CID 69307870
ethyl 4-(1,3-benzodioxol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 69307870) has the molecular formula C21H20N6O6 and a molecular weight of 452.43 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(1,3-benzodioxol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 69307870 |
| Molecular Formula | C21H20N6O6 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | ethyl 4-(1,3-benzodioxol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H20N6O6/c1-2-31-20(28)15-11-25-21(23-8-7-22-18-6-4-14(10-24-18)27(29)30)26-19(15)13-3-5-16-17(9-13)33-12-32-16/h3-6,9-11H,2,7-8,12H2,1H3,(H,22,24)(H,23,25,26) |
| InChIKey | MDFWLSIERXUVSK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|