C24H28N8O5 — CID 22142463
ethyl 2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4-morpholin-4-ylphenyl)pyrimidine-5-carboxylate (PubChem CID 22142463) has the molecular formula C24H28N8O5 and a molecular weight of 508.54 g/mol. Its IUPAC name is ethyl 2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4-morpholin-4-ylphenyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4-morpholin-4-ylphenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142463 |
| Molecular Formula | C24H28N8O5 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | ethyl 2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4-morpholin-4-ylphenyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc([N+](=O)[O-])c(N)n2)nc1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28N8O5/c1-2-37-23(33)18-15-28-24(27-10-9-26-20-8-7-19(32(34)35)22(25)29-20)30-21(18)16-3-5-17(6-4-16)31-11-13-36-14-12-31/h3-8,15H,2,9-14H2,1H3,(H3,25,26,29)(H,27,28,30) |
| InChIKey | AOJDZYGVUHQPEL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|