C19H21N5O6 — CID 10454504
ethyl 2-[(2-morpholin-4-ylacetyl)amino]-4-(3-nitrophenyl)pyrimidine-5-carboxylate (PubChem CID 10454504) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is ethyl 2-[(2-morpholin-4-ylacetyl)amino]-4-(3-nitrophenyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[(2-morpholin-4-ylacetyl)amino]-4-(3-nitrophenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10454504 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 2-[(2-morpholin-4-ylacetyl)amino]-4-(3-nitrophenyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)CN2CCOCC2)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N5O6/c1-2-30-18(26)15-11-20-19(21-16(25)12-23-6-8-29-9-7-23)22-17(15)13-4-3-5-14(10-13)24(27)28/h3-5,10-11H,2,6-9,12H2,1H3,(H,20,21,22,25) |
| InChIKey | SSDAXSGVJJXAOW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|