C20H18Cl2N6O4 — CID 22142506
ethyl 4-(3,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 22142506) has the molecular formula C20H18Cl2N6O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is ethyl 4-(3,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142506 |
| Molecular Formula | C20H18Cl2N6O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | ethyl 4-(3,4-dichlorophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N6O4/c1-2-32-19(29)14-11-26-20(27-18(14)12-3-5-15(21)16(22)9-12)24-8-7-23-17-6-4-13(10-25-17)28(30)31/h3-6,9-11H,2,7-8H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | ZAPVFUKYYRAXMK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|