C20H17N9O4 — CID 172739716
2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-4-[4-(1,2,4-triazol-4-yl)phenyl]pyrimidine-5-carboxylic acid (PubChem CID 172739716) has the molecular formula C20H17N9O4 and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-4-[4-(1,2,4-triazol-4-yl)phenyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-4-[4-(1,2,4-triazol-4-yl)phenyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 172739716 |
| Molecular Formula | C20H17N9O4 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-4-[4-(1,2,4-triazol-4-yl)phenyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C20H17N9O4/c30-19(31)16-10-24-20(22-8-7-21-17-6-5-15(9-23-17)29(32)33)27-18(16)13-1-3-14(4-2-13)28-11-25-26-12-28/h1-6,9-12H,7-8H2,(H,21,23)(H,30,31)(H,22,24,27) |
| InChIKey | IXUQBGGRXZASRI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|