C21H17N9O2 — CID 22142480
4-[5-(1H-imidazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile (PubChem CID 22142480) has the molecular formula C21H17N9O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-[5-(1H-imidazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[5-(1H-imidazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 22142480 |
| Molecular Formula | C21H17N9O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[5-(1H-imidazol-5-yl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(NCCNc3ccc([N+](=O)[O-])cn3)ncc2-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C21H17N9O2/c22-9-14-1-3-15(4-2-14)20-17(18-12-23-13-28-18)11-27-21(29-20)25-8-7-24-19-6-5-16(10-26-19)30(31)32/h1-6,10-13H,7-8H2,(H,23,28)(H,24,26)(H,25,27,29) |
| InChIKey | DNLVFKNMIJDSOV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|