C20H16ClN7O2 — CID 173234269
N-[2-[4-(2-chlorophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine (PubChem CID 173234269) has the molecular formula C20H16ClN7O2 and a molecular weight of 421.85 g/mol. Its IUPAC name is N-[2-[4-(2-chlorophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[2-[4-(2-chlorophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 173234269 |
| Molecular Formula | C20H16ClN7O2 |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[2-[4-(2-chlorophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]ethyl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCc2ncc(-c3cnc[nH]3)c(-c3ccccc3Cl)n2)nc1 |
| InChI | InChI=1S/C20H16ClN7O2/c21-16-4-2-1-3-14(16)20-15(17-11-22-12-26-17)10-25-19(27-20)7-8-23-18-6-5-13(9-24-18)28(29)30/h1-6,9-12H,7-8H2,(H,22,26)(H,23,24) |
| InChIKey | AQEXGJRWKRXLEX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|