C18H18Cl2N6O2 — CID 68710531
N-[2-[5-(2-aminoethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]ethyl]-5-nitropyridin-2-amine (PubChem CID 68710531) has the molecular formula C18H18Cl2N6O2 and a molecular weight of 421.29 g/mol. Its IUPAC name is N-[2-[5-(2-aminoethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[2-[5-(2-aminoethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 68710531 |
| Molecular Formula | C18H18Cl2N6O2 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[2-[5-(2-aminoethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]ethyl]-5-nitropyridin-2-amine |
| SMILES | NCCc1c(-c2ccc(Cl)cc2Cl)ncn1CCNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C18H18Cl2N6O2/c19-12-1-3-14(15(20)9-12)18-16(5-6-21)25(11-24-18)8-7-22-17-4-2-13(10-23-17)26(27)28/h1-4,9-11H,5-8,21H2,(H,22,23) |
| InChIKey | HZIZWCGXEPCLDN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|