C11H7Cl2N3O2 — CID 4764041
N-(2,4-dichlorophenyl)-5-nitropyridin-2-amine (PubChem CID 4764041) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-nitropyridin-2-amine.
| Compound Name | N-(2,4-dichlorophenyl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 4764041 |
| Molecular Formula | C11H7Cl2N3O2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C11H7Cl2N3O2/c12-7-1-3-10(9(13)5-7)15-11-4-2-8(6-14-11)16(17)18/h1-6H,(H,14,15) |
| InChIKey | JYMXWANTEWVGPY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|