C10H6ClN5O4 — CID 3097917
N-(5-chloro-2-pyridinyl)-3,5-dinitropyridin-2-amine (PubChem CID 3097917) has the molecular formula C10H6ClN5O4 and a molecular weight of 295.64 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3,5-dinitropyridin-2-amine.
| Compound Name | N-(5-chloro-2-pyridinyl)-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 3097917 |
| Molecular Formula | C10H6ClN5O4 |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3,5-dinitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccc(Cl)cn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H6ClN5O4/c11-6-1-2-9(12-4-6)14-10-8(16(19)20)3-7(5-13-10)15(17)18/h1-5H,(H,12,13,14) |
| InChIKey | LFQZRGHJOLHCGV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|