C6H4N8O4 — CID 175584843
3,5-dinitro-N-(2H-tetrazol-5-yl)pyridin-2-amine (PubChem CID 175584843) has the molecular formula C6H4N8O4 and a molecular weight of 252.15 g/mol. Its IUPAC name is 3,5-dinitro-N-(2H-tetrazol-5-yl)pyridin-2-amine.
| Compound Name | 3,5-dinitro-N-(2H-tetrazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 175584843 |
| Molecular Formula | C6H4N8O4 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3,5-dinitro-N-(2H-tetrazol-5-yl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2nn[nH]n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N8O4/c15-13(16)3-1-4(14(17)18)5(7-2-3)8-6-9-11-12-10-6/h1-2H,(H2,7,8,9,10,11,12) |
| InChIKey | DHQJBBASJBHPOY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|